C20H25NO9 — CID 101010152
[(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-anilinooxan-2-yl]methyl acetate (PubChem CID 101010152) has the molecular formula C20H25NO9 and a molecular weight of 423.42 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-anilinooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-anilinooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101010152 |
| Molecular Formula | C20H25NO9 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [(2R,3R,4S,5R)-3,4,5-triacetyloxy-6-anilinooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(Nc2ccccc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H25NO9/c1-11(22)26-10-16-17(27-12(2)23)18(28-13(3)24)19(29-14(4)25)20(30-16)21-15-8-6-5-7-9-15/h5-9,16-21H,10H2,1-4H3/t16-,17-,18+,19-,20?/m1/s1 |
| InChIKey | BUWRELKHEYDARI-QUIYGKKVSA-N |
| XLogP | 1.18 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|