C12H16FNO5 — CID 171384019
(3R,4S,5S,6R)-2-(4-fluoroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 171384019) has the molecular formula C12H16FNO5 and a molecular weight of 273.26 g/mol. Its IUPAC name is (3R,4S,5S,6R)-2-(4-fluoroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (3R,4S,5S,6R)-2-(4-fluoroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 171384019 |
| Molecular Formula | C12H16FNO5 |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (3R,4S,5S,6R)-2-(4-fluoroanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1OC(Nc2ccc(F)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16FNO5/c13-6-1-3-7(4-2-6)14-12-11(18)10(17)9(16)8(5-15)19-12/h1-4,8-12,14-18H,5H2/t8-,9-,10+,11-,12?/m1/s1 |
| InChIKey | FDZNUEUIZPIJEN-OZRWLHRGSA-N |
| XLogP | -0.96 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |