C12H16ClNO5 — CID 3894098
2-(4-chloroanilino)-5-(1,2-dihydroxyethyl)oxolane-3,4-diol (PubChem CID 3894098) has the molecular formula C12H16ClNO5 and a molecular weight of 289.72 g/mol. Its IUPAC name is 2-(4-chloroanilino)-5-(1,2-dihydroxyethyl)oxolane-3,4-diol.
| Compound Name | 2-(4-chloroanilino)-5-(1,2-dihydroxyethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 3894098 |
| Molecular Formula | C12H16ClNO5 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(4-chloroanilino)-5-(1,2-dihydroxyethyl)oxolane-3,4-diol |
| SMILES | OCC(O)C1OC(Nc2ccc(Cl)cc2)C(O)C1O |
| InChI | InChI=1S/C12H16ClNO5/c13-6-1-3-7(4-2-6)14-12-10(18)9(17)11(19-12)8(16)5-15/h1-4,8-12,14-18H,5H2 |
| InChIKey | LWJXCPUBUNYREK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |