C32H41NO17 — CID 91725290
[(2R,3R,4S,5R)-4,5-diacetyloxy-6-anilino-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 91725290) has the molecular formula C32H41NO17 and a molecular weight of 711.67 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4,5-diacetyloxy-6-anilino-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-6-anilino-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 91725290 |
| Molecular Formula | C32H41NO17 |
| Molecular Weight | 711.67 g/mol |
| Exact Mass | 711.24 |
| IUPAC Name | [(2R,3R,4S,5R)-4,5-diacetyloxy-6-anilino-3-[3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC(O[C@H]2[C@H](OC(C)=O)[C@@H](OC(C)=O)C(Nc3ccccc3)O[C@@H]2COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C32H41NO17/c1-15(34)41-13-23-26(27(44-18(4)37)29(46-20(6)39)31(48-23)33-22-11-9-8-10-12-22)50-32-30(47-21(7)40)28(45-19(5)38)25(43-17(3)36)24(49-32)14-42-16(2)35/h8-12,23-33H,13-14H2,1-7H3/t23-,24?,25?,26-,27+,28?,29-,30?,31?,32?/m1/s1 |
| InChIKey | RKLVWXMJOGRZAN-RDPZOGMKSA-N |
| XLogP | 0.72 |
| TPSA | 223.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.67 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|