C14H18FNO5 — CID 101066652
(4aR,6R,7R,8R,8aS)-6-(2-fluoroanilino)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol (PubChem CID 101066652) has the molecular formula C14H18FNO5 and a molecular weight of 299.30 g/mol. Its IUPAC name is (4aR,6R,7R,8R,8aS)-6-(2-fluoroanilino)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol.
| Compound Name | (4aR,6R,7R,8R,8aS)-6-(2-fluoroanilino)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
|---|---|
| PubChem CID | 101066652 |
| Molecular Formula | C14H18FNO5 |
| Molecular Weight | 299.30 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (4aR,6R,7R,8R,8aS)-6-(2-fluoroanilino)-2-methyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-7,8-diol |
| SMILES | CC1OC[C@H]2O[C@@H](Nc3ccccc3F)[C@H](O)[C@@H](O)[C@@H]2O1 |
| InChI | InChI=1S/C14H18FNO5/c1-7-19-6-10-13(20-7)11(17)12(18)14(21-10)16-9-5-3-2-4-8(9)15/h2-5,7,10-14,16-18H,6H2,1H3/t7?,10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | JEQTUXYYFNIJCV-GIVSSIFGSA-N |
| XLogP | 0.45 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |