C22H28N2O6 — CID 508361
(6S)-3-benzyl-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 508361) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is (6S)-3-benzyl-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | (6S)-3-benzyl-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 508361 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (6S)-3-benzyl-1-cyclopropyl-6-[(6S)-6-methoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CO[C@@H]1C2OC(C)(C)OC2OC1[C@@H]1CC(=O)N(Cc2ccccc2)C(=O)N1C1CC1 |
| InChI | InChI=1S/C22H28N2O6/c1-22(2)29-19-18(27-3)17(28-20(19)30-22)15-11-16(25)23(12-13-7-5-4-6-8-13)21(26)24(15)14-9-10-14/h4-8,14-15,17-20H,9-12H2,1-3H3/t15-,17?,18-,19?,20?/m0/s1 |
| InChIKey | YXSGKOSOQKOFLZ-GGDKKLJYSA-N |
| XLogP | 2.26 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |