C25H37NO7 — CID 11178749
propan-2-yl (2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate (PubChem CID 11178749) has the molecular formula C25H37NO7 and a molecular weight of 463.57 g/mol. Its IUPAC name is propan-2-yl (2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate.
| Compound Name | propan-2-yl (2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
|---|---|
| PubChem CID | 11178749 |
| Molecular Formula | C25H37NO7 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | propan-2-yl (2S)-2-[[(1S)-1-phenylethyl]amino]-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]propanoate |
| SMILES | CC(C)OC(=O)[C@H](C[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)N[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H37NO7/c1-14(2)28-22(27)17(26-15(3)16-11-9-8-10-12-16)13-18-19-20(31-24(4,5)30-19)21-23(29-18)33-25(6,7)32-21/h8-12,14-15,17-21,23,26H,13H2,1-7H3/t15-,17-,18+,19-,20-,21+,23+/m0/s1 |
| InChIKey | FWMGQXFROIHSSD-GXSNOCKVSA-N |
| XLogP | 3.44 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |