C22H31NO7 — CID 101200380
methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate (PubChem CID 101200380) has the molecular formula C22H31NO7 and a molecular weight of 421.49 g/mol. Its IUPAC name is methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
|---|---|
| PubChem CID | 101200380 |
| Molecular Formula | C22H31NO7 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | methyl 2-[(3aR,4R,6S,6aR)-4-(benzylamino)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@@]1(NCc2ccccc2)O[C@@H]([C@H]2COC(C)(C)O2)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C22H31NO7/c1-20(2)26-13-15(27-20)17-18-19(30-21(3,4)28-18)22(29-17,11-16(24)25-5)23-12-14-9-7-6-8-10-14/h6-10,15,17-19,23H,11-13H2,1-5H3/t15-,17+,18-,19-,22-/m1/s1 |
| InChIKey | XSSVJMDKVIIIJS-PNSRMYRDSA-N |
| XLogP | 2.11 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |