C20H29NO7 — CID 135013251
methyl 4-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-[benzyl(hydroxy)amino]butanoate (PubChem CID 135013251) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is methyl 4-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-[benzyl(hydroxy)amino]butanoate.
| Compound Name | methyl 4-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-[benzyl(hydroxy)amino]butanoate |
|---|---|
| PubChem CID | 135013251 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | methyl 4-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-4-[benzyl(hydroxy)amino]butanoate |
| SMILES | COC(=O)CCC([C@H]1O[C@H](OC)[C@H]2OC(C)(C)O[C@H]21)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C20H29NO7/c1-20(2)27-17-16(26-19(25-4)18(17)28-20)14(10-11-15(22)24-3)21(23)12-13-8-6-5-7-9-13/h5-9,14,16-19,23H,10-12H2,1-4H3/t14?,16-,17+,18+,19+/m1/s1 |
| InChIKey | LVDQQWPCAXIHRS-BBUSSKQMSA-N |
| XLogP | 2.09 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|