C21H29NO5 — CID 53494485
(5S)-1-benzyl-5-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidin-2-one (PubChem CID 53494485) has the molecular formula C21H29NO5 and a molecular weight of 375.47 g/mol. Its IUPAC name is (5S)-1-benzyl-5-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidin-2-one.
| Compound Name | (5S)-1-benzyl-5-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 53494485 |
| Molecular Formula | C21H29NO5 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (5S)-1-benzyl-5-[(4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrrolidin-2-one |
| SMILES | CC1(C)O[C@@H]([C@@H]2CCC(=O)N2Cc2ccccc2)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C21H29NO5/c1-20(2)24-13-16(25-20)19-18(26-21(3,4)27-19)15-10-11-17(23)22(15)12-14-8-6-5-7-9-14/h5-9,15-16,18-19H,10-13H2,1-4H3/t15-,16+,18-,19+/m0/s1 |
| InChIKey | AMWLQTPLWFCJJH-OGWHTMIXSA-N |
| XLogP | 2.85 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |