C24H33NO7 — CID 71725813
(4R,5S)-3-[(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 71725813) has the molecular formula C24H33NO7 and a molecular weight of 447.53 g/mol. Its IUPAC name is (4R,5S)-3-[(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71725813 |
| Molecular Formula | C24H33NO7 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (4R,5S)-3-[(3S)-3-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(methoxymethoxy)-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@@H](OCOC)C(C)(C)C(=O)N1C(=O)O[C@@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H33NO7/c1-8-17-19(32-24(5,6)31-17)20(29-14-28-7)23(3,4)21(26)25-18(15(2)30-22(25)27)16-12-10-9-11-13-16/h8-13,15,17-20H,1,14H2,2-7H3/t15-,17-,18-,19-,20+/m0/s1 |
| InChIKey | IMMVLJPEMUSXHG-ONSCTEFMSA-N |
| XLogP | 3.82 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|