C23H31NO6 — CID 71726099
(4R,5S)-3-[(3S)-3-[(4R,5S)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 71726099) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is (4R,5S)-3-[(3S)-3-[(4R,5S)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[(3S)-3-[(4R,5S)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71726099 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | (4R,5S)-3-[(3S)-3-[(4R,5S)-2,2-dimethyl-5-prop-1-en-2-yl-1,3-dioxolan-4-yl]-3-hydroxy-2,2-dimethylpropanoyl]-5-methyl-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C(C)[C@@H]1OC(C)(C)O[C@@H]1[C@@H](O)C(C)(C)C(=O)N1C(=O)O[C@@H](C)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H31NO6/c1-13(2)17-18(30-23(6,7)29-17)19(25)22(4,5)20(26)24-16(14(3)28-21(24)27)15-11-9-8-10-12-15/h8-12,14,16-19,25H,1H2,2-7H3/t14-,16-,17-,18-,19+/m0/s1 |
| InChIKey | GZVLVSXAHALYGF-XFUTXVRSSA-N |
| XLogP | 3.58 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|