C22H35NO4Si — CID 135013430
(5R)-1-benzyl-5-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]pyrrolidin-2-one (PubChem CID 135013430) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is (5R)-1-benzyl-5-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]pyrrolidin-2-one.
| Compound Name | (5R)-1-benzyl-5-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 135013430 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | (5R)-1-benzyl-5-[(2S,4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]pyrrolidin-2-one |
| SMILES | C[C@H]1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@H]2CCC(=O)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H35NO4Si/c1-16-25-15-19(27-28(5,6)22(2,3)4)21(26-16)18-12-13-20(24)23(18)14-17-10-8-7-9-11-17/h7-11,16,18-19,21H,12-15H2,1-6H3/t16-,18+,19+,21+/m0/s1 |
| InChIKey | FRIYZJHRINKFCL-HKJQZYRSSA-N |
| XLogP | 4.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|