C23H39NO6Si — CID 135013614
methyl 4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]butanoate (PubChem CID 135013614) has the molecular formula C23H39NO6Si and a molecular weight of 453.65 g/mol. Its IUPAC name is methyl 4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]butanoate.
| Compound Name | methyl 4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]butanoate |
|---|---|
| PubChem CID | 135013614 |
| Molecular Formula | C23H39NO6Si |
| Molecular Weight | 453.65 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | methyl 4-[benzyl(hydroxy)amino]-4-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]butanoate |
| SMILES | COC(=O)CCC([C@@H]1O[C@H](C)OC[C@H]1O[Si](C)(C)C(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C23H39NO6Si/c1-17-28-16-20(30-31(6,7)23(2,3)4)22(29-17)19(13-14-21(25)27-5)24(26)15-18-11-9-8-10-12-18/h8-12,17,19-20,22,26H,13-16H2,1-7H3/t17-,19?,20-,22+/m1/s1 |
| InChIKey | PGRYNIKDCFHKKF-PNRDAXNWSA-N |
| XLogP | 4.35 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|