C22H37NO6Si — CID 102252150
methyl (2R,3R)-3-[benzyl(hydroxy)amino]-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate (PubChem CID 102252150) has the molecular formula C22H37NO6Si and a molecular weight of 439.63 g/mol. Its IUPAC name is methyl (2R,3R)-3-[benzyl(hydroxy)amino]-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate.
| Compound Name | methyl (2R,3R)-3-[benzyl(hydroxy)amino]-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
|---|---|
| PubChem CID | 102252150 |
| Molecular Formula | C22H37NO6Si |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | methyl (2R,3R)-3-[benzyl(hydroxy)amino]-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoate |
| SMILES | COC(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@H]1COC(C)(C)O1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C22H37NO6Si/c1-21(2,3)30(7,8)29-19(20(24)26-6)18(17-15-27-22(4,5)28-17)23(25)14-16-12-10-9-11-13-16/h9-13,17-19,25H,14-15H2,1-8H3/t17-,18-,19-/m1/s1 |
| InChIKey | JXSLBZFCBAOJKJ-GUDVDZBRSA-N |
| XLogP | 3.96 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|