C22H37NO3Si — CID 135013431
[(2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 135013431) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is [(2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135013431 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(2S,4R,5R)-4-[(2R)-1-benzylpyrrolidin-2-yl]-2-methyl-1,3-dioxan-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@H]1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]([C@H]2CCCN2Cc2ccccc2)O1 |
| InChI | InChI=1S/C22H37NO3Si/c1-17-24-16-20(26-27(5,6)22(2,3)4)21(25-17)19-13-10-14-23(19)15-18-11-8-7-9-12-18/h7-9,11-12,17,19-21H,10,13-16H2,1-6H3/t17-,19+,20+,21+/m0/s1 |
| InChIKey | MNCIMYSOKJLYTJ-OYNPSCLESA-N |
| XLogP | 4.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|