C18H23NO2 — CID 134926087
2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-azabicyclo[2.2.1]hept-5-ene (PubChem CID 134926087) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-azabicyclo[2.2.1]hept-5-ene.
| Compound Name | 2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-azabicyclo[2.2.1]hept-5-ene |
|---|---|
| PubChem CID | 134926087 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-azabicyclo[2.2.1]hept-5-ene |
| SMILES | CC1(C)OC[C@H](C2C3C=CC(C3)N2Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H23NO2/c1-18(2)20-12-16(21-18)17-14-8-9-15(10-14)19(17)11-13-6-4-3-5-7-13/h3-9,14-17H,10-12H2,1-2H3/t14?,15?,16-,17?/m1/s1 |
| InChIKey | FCEHMJSMVFILPY-ONNPGMOUSA-N |
| XLogP | 2.97 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|