C25H33NO2Si — CID 66573043
(1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-yn-1-amine (PubChem CID 66573043) has the molecular formula C25H33NO2Si and a molecular weight of 407.63 g/mol. Its IUPAC name is (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-yn-1-amine.
| Compound Name | (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 66573043 |
| Molecular Formula | C25H33NO2Si |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-trimethylsilylprop-2-yn-1-amine |
| SMILES | CC1(C)OC[C@H]([C@@H](C#C[Si](C)(C)C)N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H33NO2Si/c1-25(2)27-20-24(28-25)23(16-17-29(3,4)5)26(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,23-24H,18-20H2,1-5H3/t23-,24-/m1/s1 |
| InChIKey | AYTFKLHKJICDLW-DNQXCXABSA-N |
| XLogP | 5.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|