C26H31NO4 — CID 66573044
ethyl (5R)-5-(dibenzylamino)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-ynoate (PubChem CID 66573044) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is ethyl (5R)-5-(dibenzylamino)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-ynoate.
| Compound Name | ethyl (5R)-5-(dibenzylamino)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-ynoate |
|---|---|
| PubChem CID | 66573044 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | ethyl (5R)-5-(dibenzylamino)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-3-ynoate |
| SMILES | CCOC(=O)CC#C[C@H]([C@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H31NO4/c1-4-29-25(28)17-11-16-23(24-20-30-26(2,3)31-24)27(18-21-12-7-5-8-13-21)19-22-14-9-6-10-15-22/h5-10,12-15,23-24H,4,17-20H2,1-3H3/t23-,24-/m1/s1 |
| InChIKey | IGVMKOCBDSCDOR-DNQXCXABSA-N |
| XLogP | 4.17 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|