C25H25NO3 — CID 23629604
(4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one (PubChem CID 23629604) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one.
| Compound Name | (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 23629604 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | (4R)-4-[(1S)-1-(dibenzylamino)-2-phenylethyl]-1,3-dioxolan-2-one |
| SMILES | O=C1OC[C@@H]([C@H](Cc2ccccc2)N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C25H25NO3/c27-25-28-19-24(29-25)23(16-20-10-4-1-5-11-20)26(17-21-12-6-2-7-13-21)18-22-14-8-3-9-15-22/h1-15,23-24H,16-19H2/t23-,24-/m0/s1 |
| InChIKey | JOLCWRHFYLSCBY-ZEQRLZLVSA-N |
| XLogP | 4.84 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |