C24H25NO — CID 11046158
(1S)-N,N-dibenzyl-1-[(2R)-oxiran-2-yl]-2-phenylethanamine (PubChem CID 11046158) has the molecular formula C24H25NO and a molecular weight of 343.47 g/mol. Its IUPAC name is (1S)-N,N-dibenzyl-1-[(2R)-oxiran-2-yl]-2-phenylethanamine.
| Compound Name | (1S)-N,N-dibenzyl-1-[(2R)-oxiran-2-yl]-2-phenylethanamine |
|---|---|
| PubChem CID | 11046158 |
| Molecular Formula | C24H25NO |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (1S)-N,N-dibenzyl-1-[(2R)-oxiran-2-yl]-2-phenylethanamine |
| SMILES | c1ccc(C[C@@H]([C@@H]2CO2)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C24H25NO/c1-4-10-20(11-5-1)16-23(24-19-26-24)25(17-21-12-6-2-7-13-21)18-22-14-8-3-9-15-22/h1-15,23-24H,16-19H2/t23-,24-/m0/s1 |
| InChIKey | OJMTUDXGQPAVEH-ZEQRLZLVSA-N |
| XLogP | 4.70 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|