C20H29NO2 — CID 56651054
(1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]-N-prop-2-enylbut-3-en-1-amine (PubChem CID 56651054) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]-N-prop-2-enylbut-3-en-1-amine.
| Compound Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]-N-prop-2-enylbut-3-en-1-amine |
|---|---|
| PubChem CID | 56651054 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | (1R)-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-N-[(1S)-1-phenylethyl]-N-prop-2-enylbut-3-en-1-amine |
| SMILES | C=CC[C@H]([C@H]1COC(C)(C)O1)N(CC=C)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H29NO2/c1-6-11-18(19-15-22-20(4,5)23-19)21(14-7-2)16(3)17-12-9-8-10-13-17/h6-10,12-13,16,18-19H,1-2,11,14-15H2,3-5H3/t16-,18+,19+/m0/s1 |
| InChIKey | ZOJJDPUPYQGBDJ-QXAKKESOSA-N |
| XLogP | 4.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|