C17H21NO5 — CID 11130971
methyl (4R)-4-[benzyl(hydroxy)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynoate (PubChem CID 11130971) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl (4R)-4-[benzyl(hydroxy)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynoate.
| Compound Name | methyl (4R)-4-[benzyl(hydroxy)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynoate |
|---|---|
| PubChem CID | 11130971 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | methyl (4R)-4-[benzyl(hydroxy)amino]-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]but-2-ynoate |
| SMILES | COC(=O)C#C[C@H]([C@H]1COC(C)(C)O1)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO5/c1-17(2)22-12-15(23-17)14(9-10-16(19)21-3)18(20)11-13-7-5-4-6-8-13/h4-8,14-15,20H,11-12H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | WZDZIYHASWLKTB-HUUCEWRRSA-N |
| XLogP | 1.57 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|