C26H33NO2 — CID 66573613
(1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-2-yn-1-amine (PubChem CID 66573613) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-2-yn-1-amine.
| Compound Name | (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-2-yn-1-amine |
|---|---|
| PubChem CID | 66573613 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | (1R)-N,N-dibenzyl-1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,4-dimethylpent-2-yn-1-amine |
| SMILES | CC(C)(C)C#C[C@H]([C@H]1COC(C)(C)O1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H33NO2/c1-25(2,3)17-16-23(24-20-28-26(4,5)29-24)27(18-21-12-8-6-9-13-21)19-22-14-10-7-11-15-22/h6-15,23-24H,18-20H2,1-5H3/t23-,24-/m1/s1 |
| InChIKey | XTCVDNAYWHMNNM-DNQXCXABSA-N |
| XLogP | 5.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|