C18H25NO2 — CID 56651055
(2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine (PubChem CID 56651055) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine.
| Compound Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 56651055 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(1S)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
| SMILES | C[C@@H](c1ccccc1)N1CC=CC[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H25NO2/c1-14(15-9-5-4-6-10-15)19-12-8-7-11-16(19)17-13-20-18(2,3)21-17/h4-10,14,16-17H,11-13H2,1-3H3/t14-,16+,17+/m0/s1 |
| InChIKey | WSWHSOGLFDWFIG-USXIJHARSA-N |
| XLogP | 3.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|