C25H31NO4 — CID 10692883
(1R,2R,6R,10R)-8-benzhydryl-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-azatricyclo[8.3.0.02,6]tridecane (PubChem CID 10692883) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is (1R,2R,6R,10R)-8-benzhydryl-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-azatricyclo[8.3.0.02,6]tridecane.
| Compound Name | (1R,2R,6R,10R)-8-benzhydryl-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-azatricyclo[8.3.0.02,6]tridecane |
|---|---|
| PubChem CID | 10692883 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | (1R,2R,6R,10R)-8-benzhydryl-4,4,12,12-tetramethyl-3,5,11,13-tetraoxa-8-azatricyclo[8.3.0.02,6]tridecane |
| SMILES | CC1(C)O[C@H]2[C@@H]3OC(C)(C)O[C@@H]3CN(C(c3ccccc3)c3ccccc3)C[C@H]2O1 |
| InChI | InChI=1S/C25H31NO4/c1-24(2)27-19-15-26(16-20-23(22(19)29-24)30-25(3,4)28-20)21(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,19-23H,15-16H2,1-4H3/t19-,20-,22-,23-/m1/s1 |
| InChIKey | GUPYSEOGVIYPGO-OHUMZHCVSA-N |
| XLogP | 4.13 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |