C18H23NO2 — CID 102213668
(1S,2S,6R,9S)-4,4-dimethyl-9-phenyl-3,5-dioxa-8-azatricyclo[6.5.0.02,6]tridec-11-ene (PubChem CID 102213668) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is (1S,2S,6R,9S)-4,4-dimethyl-9-phenyl-3,5-dioxa-8-azatricyclo[6.5.0.02,6]tridec-11-ene.
| Compound Name | (1S,2S,6R,9S)-4,4-dimethyl-9-phenyl-3,5-dioxa-8-azatricyclo[6.5.0.02,6]tridec-11-ene |
|---|---|
| PubChem CID | 102213668 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (1S,2S,6R,9S)-4,4-dimethyl-9-phenyl-3,5-dioxa-8-azatricyclo[6.5.0.02,6]tridec-11-ene |
| SMILES | CC1(C)O[C@@H]2[C@@H](CN3[C@H](c4ccccc4)CC=CC[C@@H]23)O1 |
| InChI | InChI=1S/C18H23NO2/c1-18(2)20-16-12-19-14(13-8-4-3-5-9-13)10-6-7-11-15(19)17(16)21-18/h3-9,14-17H,10-12H2,1-2H3/t14-,15-,16+,17-/m0/s1 |
| InChIKey | UBHZKSLRWHIKCK-NXOAAHMSSA-N |
| XLogP | 3.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|