C20H25NO4 — CID 139067593
(2S,3R,4R,5S)-2-[(dibenzylamino)methyl]-5-methyloxolane-2,3,4-triol (PubChem CID 139067593) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-[(dibenzylamino)methyl]-5-methyloxolane-2,3,4-triol.
| Compound Name | (2S,3R,4R,5S)-2-[(dibenzylamino)methyl]-5-methyloxolane-2,3,4-triol |
|---|---|
| PubChem CID | 139067593 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (2S,3R,4R,5S)-2-[(dibenzylamino)methyl]-5-methyloxolane-2,3,4-triol |
| SMILES | C[C@@H]1O[C@@](O)(CN(Cc2ccccc2)Cc2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H25NO4/c1-15-18(22)19(23)20(24,25-15)14-21(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,15,18-19,22-24H,12-14H2,1H3/t15-,18-,19+,20-/m0/s1 |
| InChIKey | GEYGVJURDKBTBM-QLIIJSOBSA-N |
| XLogP | 1.52 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |