C15H19NO3 — CID 135065060
(1S,2S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decane (PubChem CID 135065060) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is (1S,2S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decane.
| Compound Name | (1S,2S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decane |
|---|---|
| PubChem CID | 135065060 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (1S,2S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decane |
| SMILES | CC1(C)O[C@@H]2O[C@@H]3CN(Cc4ccccc4)[C@@H]3[C@@H]2O1 |
| InChI | InChI=1S/C15H19NO3/c1-15(2)18-13-12-11(17-14(13)19-15)9-16(12)8-10-6-4-3-5-7-10/h3-7,11-14H,8-9H2,1-2H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | IKVLBXQFAVAWMT-RFGFWPKPSA-N |
| XLogP | 1.75 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |