C22H35NO4Si — CID 135066209
[(1S,2S,4S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 135066209) has the molecular formula C22H35NO4Si and a molecular weight of 405.61 g/mol. Its IUPAC name is [(1S,2S,4S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(1S,2S,4S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135066209 |
| Molecular Formula | C22H35NO4Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | [(1S,2S,4S,5R,7S)-3-benzyl-9,9-dimethyl-6,8,10-trioxa-3-azatricyclo[5.3.0.02,5]decan-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[C@@H]2O[C@H]3[C@@H]([C@@H]2O1)N(Cc1ccccc1)[C@H]3CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO4Si/c1-21(2,3)28(6,7)24-14-16-18-17(19-20(25-18)27-22(4,5)26-19)23(16)13-15-11-9-8-10-12-15/h8-12,16-20H,13-14H2,1-7H3/t16-,17-,18+,19-,20-/m0/s1 |
| InChIKey | FNTBYIPNWAOGHU-KNJMJIDISA-N |
| XLogP | 4.14 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|