C28H47NO6Si — CID 135013874
[(2S,3S,4R)-1-benzyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxyazetidin-2-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 135013874) has the molecular formula C28H47NO6Si and a molecular weight of 521.77 g/mol. Its IUPAC name is [(2S,3S,4R)-1-benzyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxyazetidin-2-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,4R)-1-benzyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxyazetidin-2-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 135013874 |
| Molecular Formula | C28H47NO6Si |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.32 |
| IUPAC Name | [(2S,3S,4R)-1-benzyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-3-methoxyazetidin-2-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@H]1[C@H]([C@H]2OC(C)(C)O[C@@H]2[C@H]2COC(C)(C)O2)N(Cc2ccccc2)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H47NO6Si/c1-26(2,3)36(9,10)32-17-20-23(30-8)22(29(20)16-19-14-12-11-13-15-19)25-24(34-28(6,7)35-25)21-18-31-27(4,5)33-21/h11-15,20-25H,16-18H2,1-10H3/t20-,21+,22+,23-,24+,25+/m0/s1 |
| InChIKey | UUUUNPFDAPKNRP-JSFAVJLPSA-N |
| XLogP | 4.95 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|