C22H39NO5Si — CID 14704936
(1R,2R)-2-(benzylamino)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,3-diol (PubChem CID 14704936) has the molecular formula C22H39NO5Si and a molecular weight of 425.64 g/mol. Its IUPAC name is (1R,2R)-2-(benzylamino)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,3-diol.
| Compound Name | (1R,2R)-2-(benzylamino)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 14704936 |
| Molecular Formula | C22H39NO5Si |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (1R,2R)-2-(benzylamino)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,3-diol |
| SMILES | CC1(C)O[C@@H]([C@H](O)[C@@H](CO)NCc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H39NO5Si/c1-21(2,3)29(6,7)26-15-18-20(28-22(4,5)27-18)19(25)17(14-24)23-13-16-11-9-8-10-12-16/h8-12,17-20,23-25H,13-15H2,1-7H3/t17-,18+,19-,20-/m1/s1 |
| InChIKey | RLAUWFDIIPYHIB-IYWMVGAKSA-N |
| XLogP | 3.04 |
| TPSA | 80.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|