C14H21NO5 — CID 72836876
(2R,3S,5S)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4,5-triol (PubChem CID 72836876) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is (2R,3S,5S)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,5S)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 72836876 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2R,3S,5S)-2-[(benzylamino)methyl]-6-methoxyoxane-3,4,5-triol |
| SMILES | COC1O[C@H](CNCc2ccccc2)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H21NO5/c1-19-14-13(18)12(17)11(16)10(20-14)8-15-7-9-5-3-2-4-6-9/h2-6,10-18H,7-8H2,1H3/t10-,11-,12?,13+,14?/m1/s1 |
| InChIKey | IMINXYSREMGKIC-WCCYQHBJSA-N |
| XLogP | -0.77 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |