C29H45NO5Si — CID 15663035
(1R,2R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)propane-1,3-diol (PubChem CID 15663035) has the molecular formula C29H45NO5Si and a molecular weight of 515.77 g/mol. Its IUPAC name is (1R,2R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)propane-1,3-diol.
| Compound Name | (1R,2R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)propane-1,3-diol |
|---|---|
| PubChem CID | 15663035 |
| Molecular Formula | C29H45NO5Si |
| Molecular Weight | 515.77 g/mol |
| Exact Mass | 515.31 |
| IUPAC Name | (1R,2R)-1-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)propane-1,3-diol |
| SMILES | CC1(C)O[C@@H]([C@H](O)[C@@H](CO)N(Cc2ccccc2)Cc2ccccc2)[C@H](CO[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C29H45NO5Si/c1-28(2,3)36(6,7)33-21-25-27(35-29(4,5)34-25)26(32)24(20-31)30(18-22-14-10-8-11-15-22)19-23-16-12-9-13-17-23/h8-17,24-27,31-32H,18-21H2,1-7H3/t24-,25+,26-,27-/m1/s1 |
| InChIKey | IZBVZYGMUODUEO-HVWQDESWSA-N |
| XLogP | 4.95 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.77 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|