C23H29NO5 — CID 11418138
(3aR,6R,7S,7aS)-6-[(dibenzylamino)methyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol (PubChem CID 11418138) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (3aR,6R,7S,7aS)-6-[(dibenzylamino)methyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol.
| Compound Name | (3aR,6R,7S,7aS)-6-[(dibenzylamino)methyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
|---|---|
| PubChem CID | 11418138 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (3aR,6R,7S,7aS)-6-[(dibenzylamino)methyl]-2,2-dimethyl-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6,7-diol |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@](O)(CN(Cc3ccccc3)Cc3ccccc3)[C@H]2O)O1 |
| InChI | InChI=1S/C23H29NO5/c1-22(2)28-19-15-27-23(26,21(25)20(19)29-22)16-24(13-17-9-5-3-6-10-17)14-18-11-7-4-8-12-18/h3-12,19-21,25-26H,13-16H2,1-2H3/t19-,20-,21+,23-/m1/s1 |
| InChIKey | CJZFYLRMGVFKSN-CUDBPUKSSA-N |
| XLogP | 2.29 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |