C21H37NO5Si — CID 135012953
1-[benzyl(hydroxy)amino]-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]propan-2-ol (PubChem CID 135012953) has the molecular formula C21H37NO5Si and a molecular weight of 411.62 g/mol. Its IUPAC name is 1-[benzyl(hydroxy)amino]-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]propan-2-ol.
| Compound Name | 1-[benzyl(hydroxy)amino]-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 135012953 |
| Molecular Formula | C21H37NO5Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 1-[benzyl(hydroxy)amino]-1-[(2R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxan-4-yl]propan-2-ol |
| SMILES | CC(O)C([C@@H]1O[C@H](C)OC[C@H]1O[Si](C)(C)C(C)(C)C)N(O)Cc1ccccc1 |
| InChI | InChI=1S/C21H37NO5Si/c1-15(23)19(22(24)13-17-11-9-8-10-12-17)20-18(14-25-16(2)26-20)27-28(6,7)21(3,4)5/h8-12,15-16,18-20,23-24H,13-14H2,1-7H3/t15?,16-,18-,19?,20-/m1/s1 |
| InChIKey | UTHFLYCTBJHEOV-YPIGLURZSA-N |
| XLogP | 3.78 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|