C24H37NO6Si — CID 11419876
[(3R,5S)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]-trimethylsilane (PubChem CID 11419876) has the molecular formula C24H37NO6Si and a molecular weight of 463.65 g/mol. Its IUPAC name is [(3R,5S)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]-trimethylsilane.
| Compound Name | [(3R,5S)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 11419876 |
| Molecular Formula | C24H37NO6Si |
| Molecular Weight | 463.65 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | [(3R,5S)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidin-5-yl]-trimethylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@H]1C[C@H]([Si](C)(C)C)ON1Cc1ccccc1 |
| InChI | InChI=1S/C24H37NO6Si/c1-23(2)27-19-18(26-22-21(20(19)28-23)29-24(3,4)30-22)16-13-17(32(5,6)7)31-25(16)14-15-11-9-8-10-12-15/h8-12,16-22H,13-14H2,1-7H3/t16-,17+,18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | IXSDSZKOWVTDBT-ALRBCSKVSA-N |
| XLogP | 3.84 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|