C23H31NO8 — CID 101384313
methyl (3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine-5-carboxylate (PubChem CID 101384313) has the molecular formula C23H31NO8 and a molecular weight of 449.50 g/mol. Its IUPAC name is methyl (3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine-5-carboxylate.
| Compound Name | methyl (3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine-5-carboxylate |
|---|---|
| PubChem CID | 101384313 |
| Molecular Formula | C23H31NO8 |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | methyl (3R,5R)-2-benzyl-3-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]-1,2-oxazolidine-5-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]3OC(C)(C)O[C@H]32)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C23H31NO8/c1-22(2)28-17-16(27-21-19(18(17)29-22)30-23(3,4)31-21)14-11-15(20(25)26-5)32-24(14)12-13-9-7-6-8-10-13/h6-10,14-19,21H,11-12H2,1-5H3/t14-,15-,16-,17+,18+,19-,21-/m1/s1 |
| InChIKey | AEPMFFHKUWOCQV-IWAFHXCCSA-N |
| XLogP | 2.13 |
| TPSA | 84.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |