C25H33NO10 — CID 135016042
dimethyl (4S,5R)-2-benzyl-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1,2-oxazolidine-4,5-dicarboxylate (PubChem CID 135016042) has the molecular formula C25H33NO10 and a molecular weight of 507.54 g/mol. Its IUPAC name is dimethyl (4S,5R)-2-benzyl-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1,2-oxazolidine-4,5-dicarboxylate.
| Compound Name | dimethyl (4S,5R)-2-benzyl-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1,2-oxazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 135016042 |
| Molecular Formula | C25H33NO10 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | dimethyl (4S,5R)-2-benzyl-3-(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl)-1,2-oxazolidine-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1ON(Cc2ccccc2)C(C2OC3OC(C)(C)OC3C3OC(C)(C)OC32)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C25H33NO10/c1-24(2)32-18-17(31-23-20(19(18)33-24)34-25(3,4)35-23)15-14(21(27)29-5)16(22(28)30-6)36-26(15)12-13-10-8-7-9-11-13/h7-11,14-20,23H,12H2,1-6H3/t14-,15?,16+,17?,18?,19?,20?,23?/m0/s1 |
| InChIKey | OVXDZDWUVOAOTN-QDRUTMDYSA-N |
| XLogP | 1.53 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |