C20H25NO8 — CID 134985640
dimethyl (3R,4S,5R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate (PubChem CID 134985640) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is dimethyl (3R,4S,5R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate.
| Compound Name | dimethyl (3R,4S,5R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 134985640 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | dimethyl (3R,4S,5R)-2-[(3aR,4R,6aR)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-3-phenyl-1,2-oxazolidine-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](C(=O)OC)ON([C@@H]2OC[C@H]3OC(C)(C)O[C@@H]23)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H25NO8/c1-20(2)27-12-10-26-17(15(12)28-20)21-14(11-8-6-5-7-9-11)13(18(22)24-3)16(29-21)19(23)25-4/h5-9,12-17H,10H2,1-4H3/t12-,13+,14+,15-,16-,17-/m1/s1 |
| InChIKey | DPXJQKUQEYTFGO-VCCANDMLSA-N |
| XLogP | 1.18 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |