C16H19NO4 — CID 102267768
(3R,3aR,6aR)-1-benzyl-3-[(2S)-oxolan-2-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one (PubChem CID 102267768) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3R,3aR,6aR)-1-benzyl-3-[(2S)-oxolan-2-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one.
| Compound Name | (3R,3aR,6aR)-1-benzyl-3-[(2S)-oxolan-2-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 102267768 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (3R,3aR,6aR)-1-benzyl-3-[(2S)-oxolan-2-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
| SMILES | O=C1OC[C@H]2[C@@H]1[C@H]([C@@H]1CCCO1)ON2Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO4/c18-16-14-12(10-20-16)17(9-11-5-2-1-3-6-11)21-15(14)13-7-4-8-19-13/h1-3,5-6,12-15H,4,7-10H2/t12-,13-,14+,15-/m0/s1 |
| InChIKey | NJRYGQKDXWSOCH-XQLPTFJDSA-N |
| XLogP | 1.52 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |