C16H19NO6 — CID 15866809
ethyl (3S,3aR,6R,6aS)-2-benzyl-6-(hydroxymethyl)-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 15866809) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is ethyl (3S,3aR,6R,6aS)-2-benzyl-6-(hydroxymethyl)-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl (3S,3aR,6R,6aS)-2-benzyl-6-(hydroxymethyl)-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 15866809 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | ethyl (3S,3aR,6R,6aS)-2-benzyl-6-(hydroxymethyl)-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)O[C@H](CO)[C@H]2ON1Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO6/c1-2-21-16(20)13-12-14(11(9-18)22-15(12)19)23-17(13)8-10-6-4-3-5-7-10/h3-7,11-14,18H,2,8-9H2,1H3/t11-,12-,13+,14-/m1/s1 |
| InChIKey | FQRSKDVFQSHAQE-YIYPIFLZSA-N |
| XLogP | 0.27 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |