C20H25NO5 — CID 14660718
(3R,3aR,6aR)-1-benzyl-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one (PubChem CID 14660718) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3R,3aR,6aR)-1-benzyl-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one.
| Compound Name | (3R,3aR,6aR)-1-benzyl-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
|---|---|
| PubChem CID | 14660718 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R,3aR,6aR)-1-benzyl-3-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]-3,3a,6,6a-tetrahydrofuro[3,4-c][1,2]oxazol-4-one |
| SMILES | O=C1OC[C@H]2[C@@H]1[C@H]([C@H]1COC3(CCCCC3)O1)ON2Cc1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c22-19-17-15(12-23-19)21(11-14-7-3-1-4-8-14)26-18(17)16-13-24-20(25-16)9-5-2-6-10-20/h1,3-4,7-8,15-18H,2,5-6,9-13H2/t15-,16+,17+,18-/m0/s1 |
| InChIKey | PMFGAHIMKQBLAZ-MLHJIOFPSA-N |
| XLogP | 2.42 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |