C19H25NO5 — CID 10569663
tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzyl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate (PubChem CID 10569663) has the molecular formula C19H25NO5 and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzyl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzyl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
|---|---|
| PubChem CID | 10569663 |
| Molecular Formula | C19H25NO5 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzyl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
| SMILES | C[C@@H]1OC(=O)[C@H]2[C@@H]1[C@@H](CC(=O)OC(C)(C)C)ON2Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO5/c1-12-16-14(10-15(21)24-19(2,3)4)25-20(17(16)18(22)23-12)11-13-8-6-5-7-9-13/h5-9,12,14,16-17H,10-11H2,1-4H3/t12-,14+,16-,17+/m0/s1 |
| InChIKey | DHMJTETZCQRXBX-JSQNDZKTSA-N |
| XLogP | 2.46 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |