C20H27NO5 — CID 10689946
tert-butyl 2-[(3R,3aR,4S,6aS)-4-methyl-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate (PubChem CID 10689946) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 2-[(3R,3aR,4S,6aS)-4-methyl-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,3aR,4S,6aS)-4-methyl-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
|---|---|
| PubChem CID | 10689946 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | tert-butyl 2-[(3R,3aR,4S,6aS)-4-methyl-6-oxo-1-[(1R)-1-phenylethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
| SMILES | C[C@@H]1OC(=O)[C@@H]2[C@H]1[C@@H](CC(=O)OC(C)(C)C)ON2[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C20H27NO5/c1-12(14-9-7-6-8-10-14)21-18-17(13(2)24-19(18)23)15(26-21)11-16(22)25-20(3,4)5/h6-10,12-13,15,17-18H,11H2,1-5H3/t12-,13+,15-,17-,18+/m1/s1 |
| InChIKey | IPXOIMDXCHIKCF-AQDKSWOWSA-N |
| XLogP | 3.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |