C25H29NO5 — CID 10836048
tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzhydryl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate (PubChem CID 10836048) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzhydryl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate.
| Compound Name | tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzhydryl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
|---|---|
| PubChem CID | 10836048 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | tert-butyl 2-[(3R,3aS,4S,6aR)-1-benzhydryl-4-methyl-6-oxo-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-3-yl]acetate |
| SMILES | C[C@@H]1OC(=O)[C@H]2[C@@H]1[C@@H](CC(=O)OC(C)(C)C)ON2C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H29NO5/c1-16-21-19(15-20(27)30-25(2,3)4)31-26(23(21)24(28)29-16)22(17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14,16,19,21-23H,15H2,1-4H3/t16-,19+,21-,23+/m0/s1 |
| InChIKey | CJZSFLKIVMYSOM-DTPUHQDNSA-N |
| XLogP | 4.05 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |