C14H17NO3 — CID 134925341
(3S,3aR,6aR)-2-benzyl-3-ethyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one (PubChem CID 134925341) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (3S,3aR,6aR)-2-benzyl-3-ethyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one.
| Compound Name | (3S,3aR,6aR)-2-benzyl-3-ethyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
|---|---|
| PubChem CID | 134925341 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (3S,3aR,6aR)-2-benzyl-3-ethyl-3,3a,6,6a-tetrahydrofuro[2,3-d][1,2]oxazol-5-one |
| SMILES | CC[C@H]1[C@H]2OC(=O)C[C@H]2ON1Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO3/c1-2-11-14-12(8-13(16)17-14)18-15(11)9-10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3/t11-,12+,14+/m0/s1 |
| InChIKey | JPKXBHKUHOWBFS-OUCADQQQSA-N |
| XLogP | 1.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |