C22H31NO6 — CID 16752966
(3S,5R)-1-benzyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pyrrolidin-3-ol (PubChem CID 16752966) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is (3S,5R)-1-benzyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pyrrolidin-3-ol.
| Compound Name | (3S,5R)-1-benzyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 16752966 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (3S,5R)-1-benzyl-5-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]pyrrolidin-3-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@H]1C[C@H](O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H31NO6/c1-21(2)26-17-16(25-20-19(18(17)27-21)28-22(3,4)29-20)15-10-14(24)12-23(15)11-13-8-6-5-7-9-13/h5-9,14-20,24H,10-12H2,1-4H3/t14-,15+,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | UCRNLYYCFMMJFI-AKIVOZEDSA-N |
| XLogP | 2.02 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |