C31H49NO6Si — CID 10393021
(2R,3R)-3-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)-3-(methoxymethoxy)propan-1-ol (PubChem CID 10393021) has the molecular formula C31H49NO6Si and a molecular weight of 559.82 g/mol. Its IUPAC name is (2R,3R)-3-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)-3-(methoxymethoxy)propan-1-ol.
| Compound Name | (2R,3R)-3-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)-3-(methoxymethoxy)propan-1-ol |
|---|---|
| PubChem CID | 10393021 |
| Molecular Formula | C31H49NO6Si |
| Molecular Weight | 559.82 g/mol |
| Exact Mass | 559.33 |
| IUPAC Name | (2R,3R)-3-[(4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(dibenzylamino)-3-(methoxymethoxy)propan-1-ol |
| SMILES | COCO[C@@H]([C@@H]1OC(C)(C)O[C@H]1CO[Si](C)(C)C(C)(C)C)[C@@H](CO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C31H49NO6Si/c1-30(2,3)39(7,8)36-22-27-29(38-31(4,5)37-27)28(35-23-34-6)26(21-33)32(19-24-15-11-9-12-16-24)20-25-17-13-10-14-18-25/h9-18,26-29,33H,19-23H2,1-8H3/t26-,27+,28-,29-/m1/s1 |
| InChIKey | XRZTZIMSGIMNOJ-VJLHXPKFSA-N |
| XLogP | 5.58 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.82 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|