C17H21NO3 — CID 162416170
(1R,2R,6R,8R)-12-benzyl-4,4-dimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodec-9-ene (PubChem CID 162416170) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is (1R,2R,6R,8R)-12-benzyl-4,4-dimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodec-9-ene.
| Compound Name | (1R,2R,6R,8R)-12-benzyl-4,4-dimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodec-9-ene |
|---|---|
| PubChem CID | 162416170 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | (1R,2R,6R,8R)-12-benzyl-4,4-dimethyl-3,5,7-trioxa-12-azatricyclo[6.4.0.02,6]dodec-9-ene |
| SMILES | CC1(C)O[C@H]2O[C@@H]3C=CCN(Cc4ccccc4)[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C17H21NO3/c1-17(2)20-15-14-13(19-16(15)21-17)9-6-10-18(14)11-12-7-4-3-5-8-12/h3-9,13-16H,10-11H2,1-2H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | DINOFRIFFCTFSO-KLHDSHLOSA-N |
| XLogP | 2.30 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|